1,2-Ethanedione,1,2-bis(3,4-dimethoxyphenyl) structure
|
Common Name | 1,2-Ethanedione,1,2-bis(3,4-dimethoxyphenyl) | ||
|---|---|---|---|---|
| CAS Number | 554-34-7 | Molecular Weight | 330.33200 | |
| Density | 1.195g/cm3 | Boiling Point | 505.6ºC at 760mmHg | |
| Molecular Formula | C18H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.6ºC | |
| Name | 1,2-bis(3,4-dimethoxyphenyl)ethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 505.6ºC at 760mmHg |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.33200 |
| Flash Point | 223.6ºC |
| Exact Mass | 330.11000 |
| PSA | 71.06000 |
| LogP | 2.78660 |
| Index of Refraction | 1.549 |
| InChIKey | GMPWPTYBCCEVKH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(=O)c2ccc(OC)c(OC)c2)cc1OC |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 3,3',4,4'-tetramethyloxybenzyl |
| 3,3',4,4'-Tetramethoxybenzil |
| Veratril |