D-Aminoglutethimide structure
|
Common Name | D-Aminoglutethimide | ||
|---|---|---|---|---|
| CAS Number | 55511-44-9 | Molecular Weight | 232.27800 | |
| Density | 1.173g/cm3 | Boiling Point | 457.4ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O2 | Melting Point | 115.5-119.5ºC(lit.) | |
| MSDS | USA | Flash Point | 230.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of D-Aminoglutethimide(R)-(+)-Aminoglutethimide is a potent and orally active aromatase inhibitor. (R)-(+)-Aminoglutethimide has the potential for the research of breast cancer[1]. |
| Name | (R)-aminoglutethimide |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-(+)-Aminoglutethimide is a potent and orally active aromatase inhibitor. (R)-(+)-Aminoglutethimide has the potential for the research of breast cancer[1]. |
|---|---|
| Related Catalog | |
| In Vivo | (R)-(+)-Aminoglutethimide (5, 50 mg/kg; p.o.) eliminates within 48 hr into urine and feces, mostly in the form of metabolites[2]. (R)-(+)-Aminoglutethimide (1, 10, 50 mg/kg; i.p.; 60 min before training) dose not induce any significant effect in 1 and 10 mg/kg, induces a loss of retention at 50 mg/kg in day-old chicks[3]. |
| References |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 457.4ºC at 760 mmHg |
| Melting Point | 115.5-119.5ºC(lit.) |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.27800 |
| Flash Point | 230.4ºC |
| Exact Mass | 232.12100 |
| PSA | 72.19000 |
| LogP | 1.73730 |
| Index of Refraction | 1.566 |
| InChIKey | ROBVIMPUHSLWNV-CYBMUJFWSA-N |
| SMILES | CCC1(c2ccc(N)cc2)CCC(=O)NC1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| (3R)-3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione |
| Aminoglutethimide,d |
| MFCD03094025 |