Benzyltrimethylammonium chloride structure
|
Common Name | Benzyltrimethylammonium chloride | ||
|---|---|---|---|---|
| CAS Number | 56-93-9 | Molecular Weight | 185.694 | |
| Density | 1.08 g/mL at 25 °C | Boiling Point | >135ºC (Some decomp) | |
| Molecular Formula | C10H16ClN | Melting Point | 239 °C (dec.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzyltrimethylammonium chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08 g/mL at 25 °C |
|---|---|
| Boiling Point | >135ºC (Some decomp) |
| Melting Point | 239 °C (dec.)(lit.) |
| Molecular Formula | C10H16ClN |
| Molecular Weight | 185.694 |
| Exact Mass | 185.097122 |
| Index of Refraction | n20/D 1.479 |
| InChIKey | KXHPPCXNWTUNSB-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)Cc1ccccc1.[Cl-] |
| Stability | Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| Water Solubility | 800 g/L |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xn:Harmful |
|---|---|
| Risk Phrases | R22;R36/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BO8400000 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 29239000 |
|
~70%
Benzyltrimethyl... CAS#:56-93-9 |
| Literature: Vedejs, Edwin; Monahan, Sean D. Journal of Organic Chemistry, 1997 , vol. 62, # 14 p. 4763 - 4769 |
|
~94%
Benzyltrimethyl... CAS#:56-93-9 |
| Literature: Hilhorst, Ellen; Chen, Tjoe B. R. A.; Iskander, Atef S.; Pandit, Upendra K. Tetrahedron, 1994 , vol. 50, # 26 p. 7837 - 7848 |
|
~71%
Benzyltrimethyl... CAS#:56-93-9 |
| Literature: Zheng, Zhuo Qun; Wang, Jie; Wu, Ting Hua; Zhou, Xiao Ping Advanced Synthesis and Catalysis, 2007 , vol. 349, # 7 p. 1095 - 1101 |
|
~95%
Benzyltrimethyl... CAS#:56-93-9 |
| Literature: Shantz, Daniel F.; Fild, Christian; Koller, Hubert; Lobo, Raul F. Journal of Physical Chemistry B, 1999 , vol. 103, # 49 p. 10858 - 10865 |
|
~%
Benzyltrimethyl... CAS#:56-93-9 |
| Literature: Chemical Communications, , vol. 50, # 15 p. 1836 - 1838 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 29239000 |
|---|
|
Name: Luminescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: mu-type opioid receptor isoform MOR-1 [Homo sapiens]
External Id: OPRM1-OPRD1_AG_LUMI_1536_1X%ACT PRUN
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Cytochrome P450 Family 1 Subfamily A Member 2 (CYP1A2) small molecule antagonists: lu...
Source: 824
External Id: CYP273
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: Fluorescence polarization-based biochemical high throughput primary assay to identify...
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=Sialate O-acetylesterase; AltName: Full=H-Lse; AltName: Full=Sialic acid-specific 9-O-acetylesterase; Flags: Precursor [Homo sapiens]
External Id: SIAE_INH_FP_1536_1X%INH PRUN
|
|
Name: p53 small molecule agonists, cell-based qHTS assay: qHTS cell viability counter scree...
Source: 824
Target: N/A
External Id: P53600
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: qHTS ce...
Source: 824
Target: N/A
External Id: P53MS958
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: Summary
Source: 824
External Id: P53MS482
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with human liver microsomes
Source: 824
Target: tumor suppressor p53 [Homo sapiens]
External Id: P53MS233
|
| EINECS 200-300-3 |
| Benzyltrimethylammonium chlorid |
| TMBAC |
| MFCD00011782 |
| Benzyltrimethylammoniumchlori |
| N-benzyltrimethylammonium chloride |
| Benzyltrimethylammonium chloride |
| benzyltriMethylazaniuM chloride |
| Benzyl trimethyl ammonium chloride |
| Benzenemethanaminium, N,N,N-trimethyl-, chloride (1:1) |
| N-benzyl-N,N,N-trimethyl-ammonium chloride |
| BTMAC |
| Trimethylbenzylammonium chloride |
| N,N,N-Trimethyl(phenyl)methanaminium chloride |
| BTM |
| benzyltrimethyl-ammoniuchloride |
| Benzyltrimethyl ammoniumchloride |