Sclareolide structure
|
Common Name | Sclareolide | ||
|---|---|---|---|---|
| CAS Number | 564-20-5 | Molecular Weight | 250.376 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 321.4±10.0 °C at 760 mmHg | |
| Molecular Formula | C16H26O2 | Melting Point | 124-126ºC | |
| MSDS | Chinese USA | Flash Point | 132.4±16.4 °C | |
Use of SclareolideSclareolide is isolated from the flower of Salvia sclarea with antibacterial and cytotoxic activities[1]. |
| Name | (3aR)-(+)-Sclareolide |
|---|---|
| Synonym | More Synonyms |
| Description | Sclareolide is isolated from the flower of Salvia sclarea with antibacterial and cytotoxic activities[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: bacterial[1] |
| In Vitro | Sclareolide has a good antibacterial activity against Staphylococcus aureus ATCC 25923, Pseudomonas aeruginosa ATCC 27950, Escherichia coli ATCC 25922 and Enterococcus faecalis ATCC 29212[1]. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 321.4±10.0 °C at 760 mmHg |
| Melting Point | 124-126ºC |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.376 |
| Flash Point | 132.4±16.4 °C |
| Exact Mass | 250.193283 |
| PSA | 26.30000 |
| LogP | 4.32 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | IMKJGXCIJJXALX-SHUKQUCYSA-N |
| SMILES | CC1(C)CCCC2(C)C1CCC1(C)OC(=O)CC12 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| (3aR,9aS,9bR)-3a,6,6,9a-Tetramethyldecahydronaphtho[2,1-b]furan-2(1H)-one |
| Naphtho[2,1-b]furan-2(1H)-one, decahydro-3a,6,6,9a-tetramethyl-, (3aR,9aS,9bR)- |
| (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one |
| Sclareolide |