Pregn-5-en-20-one,21-(acetyloxy)-3-hydroxy-, (3b)- structure
|
Common Name | Pregn-5-en-20-one,21-(acetyloxy)-3-hydroxy-, (3b)- | ||
|---|---|---|---|---|
| CAS Number | 566-78-9 | Molecular Weight | 374.51400 | |
| Density | 1.15g/cm3 | Boiling Point | 500.2ºC at 760mmHg | |
| Molecular Formula | C23H34O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 166.6ºC | |
| Name | 21-Acetoxypregnenolone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 500.2ºC at 760mmHg |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.51400 |
| Flash Point | 166.6ºC |
| Exact Mass | 374.24600 |
| PSA | 63.60000 |
| LogP | 4.05850 |
| Index of Refraction | 1.549 |
| InChIKey | MDJRZSNPHZEMJH-MTMZYOSNSA-N |
| SMILES | CC(=O)OCC(=O)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| 21-acetoxypregnenolone |