AZD 2098 structure
|
Common Name | AZD 2098 | ||
|---|---|---|---|---|
| CAS Number | 566203-88-1 | Molecular Weight | 334.178 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 489.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C11H9Cl2N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.7±31.5 °C | |
Use of AZD 2098AZD2098 is a potent CC-chemokine receptor 4 (CCR4) inhibitor, used for asthma research. |
| Name | AZD2098 |
|---|---|
| Synonym | More Synonyms |
| Description | AZD2098 is a potent CC-chemokine receptor 4 (CCR4) inhibitor, used for asthma research. |
|---|---|
| Related Catalog | |
| Target |
CCR4 |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.3±55.0 °C at 760 mmHg |
| Molecular Formula | C11H9Cl2N3O3S |
| Molecular Weight | 334.178 |
| Flash Point | 249.7±31.5 °C |
| Exact Mass | 332.974182 |
| LogP | 3.32 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | FLSMVCMSUNISFK-UHFFFAOYSA-N |
| SMILES | COc1nccnc1NS(=O)(=O)c1cccc(Cl)c1Cl |
| Storage condition | 2-8℃ |
| 2,3-Dichloro-N-(3-methoxy-2-pyrazinyl)benzenesulfonamide |
| Benzenesulfonamide, 2,3-dichloro-N-(3-methoxy-2-pyrazinyl)- |