Benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone structure
|
Common Name | Benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone | ||
|---|---|---|---|---|
| CAS Number | 5690-24-4 | Molecular Weight | 266.20800 | |
| Density | 1.666g/cm3 | Boiling Point | 702.8ºC at 760mmHg | |
| Molecular Formula | C14H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.1ºC | |
| Name | 1,4,5,8-Naphthalenetetracarboxdiimide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.666g/cm3 |
|---|---|
| Boiling Point | 702.8ºC at 760mmHg |
| Molecular Formula | C14H6N2O4 |
| Molecular Weight | 266.20800 |
| Flash Point | 311.1ºC |
| Exact Mass | 266.03300 |
| PSA | 99.86000 |
| LogP | 0.11880 |
| Index of Refraction | 1.77 |
| InChIKey | BODUWJSFPLUDMP-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)c2ccc3c4c(ccc1c24)C(=O)NC3=O |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| EINECS 227-159-0 |
| Benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone |