4,5-Dichlorophthalic acid structure
|
Common Name | 4,5-Dichlorophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 56962-08-4 | Molecular Weight | 235.02100 | |
| Density | 1.698g/cm3 | Boiling Point | 422.1ºC at 760mmHg | |
| Molecular Formula | C8H4Cl2O4 | Melting Point | 198-200 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 209.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,5-Dichlorophthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.698g/cm3 |
|---|---|
| Boiling Point | 422.1ºC at 760mmHg |
| Melting Point | 198-200 °C (dec.)(lit.) |
| Molecular Formula | C8H4Cl2O4 |
| Molecular Weight | 235.02100 |
| Flash Point | 209.1ºC |
| Exact Mass | 233.94900 |
| PSA | 74.60000 |
| LogP | 2.38980 |
| Index of Refraction | 1.64 |
| InChIKey | FDOQKGWUMUEJLX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)c(Cl)cc1C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917399090 |
|
~%
4,5-Dichloropht... CAS#:56962-08-4 |
| Literature: Zhurnal Organicheskoi Khimii, , vol. 6, # 5 p. 1082 - 1086,1084 - 1088 |
|
~%
4,5-Dichloropht... CAS#:56962-08-4 |
| Literature: Journal of the Chemical Society, , p. 255 |
|
~%
4,5-Dichloropht... CAS#:56962-08-4 |
| Literature: Zeitschrift fuer Chemie (Stuttgart, Germany), , vol. 2, p. 311 |
|
~%
4,5-Dichloropht... CAS#:56962-08-4 |
| Literature: Journal of Organic Chemistry, , vol. 12, p. 617,680 |
|
~%
4,5-Dichloropht... CAS#:56962-08-4 |
| Literature: Journal of the Chemical Society, , p. 1878 |
|
~%
Detail
|
| Literature: DE725605 , ; DRP/DRBP Org.Chem. U.S. Dep. Comm. Off. Tech. Serv. Rep., , # 625 |
|
~%
4,5-Dichloropht... CAS#:56962-08-4 |
| Literature: Journal of the Chemical Society, , p. 253 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00002493 |
| EINECS 260-478-3 |
| 4,5-dichlorophthalic acid |