L-Histidine,N,1-bis(phenylmethyl)- structure
|
Common Name | L-Histidine,N,1-bis(phenylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 57101-60-7 | Molecular Weight | 335.40000 | |
| Density | 1.18g/cm3 | Boiling Point | 564.5ºC at 760mmHg | |
| Molecular Formula | C20H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.2ºC | |
| Name | bzl-his(bzl)-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 564.5ºC at 760mmHg |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.40000 |
| Flash Point | 295.2ºC |
| Exact Mass | 335.16300 |
| PSA | 67.15000 |
| LogP | 3.10780 |
| Index of Refraction | 1.613 |
| InChIKey | IUSLFTWXUDAXJI-IBGZPJMESA-N |
| SMILES | O=C(O)C(Cc1cn(Cc2ccccc2)cn1)NCc1ccccc1 |
| HS Code | 2933290090 |
|---|
|
~%
L-Histidine,N,1... CAS#:57101-60-7 |
| Literature: du Vigneaud; Behrens Journal of Biological Chemistry, 1937 , vol. 117, p. 27,32 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bzl-histidine(bzl)-oh |
| na-benzyl-n-im-benzyl-l-histidine |