Boc-His(Boc)-OH structure
|
Common Name | Boc-His(Boc)-OH | ||
|---|---|---|---|---|
| CAS Number | 20866-46-0 | Molecular Weight | 355.386 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H25N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-4-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H25N3O6 |
| Molecular Weight | 355.386 |
| Exact Mass | 355.174347 |
| PSA | 119.75000 |
| LogP | 2.05 |
| Index of Refraction | 1.534 |
| InChIKey | IXHPIPUIOSSAIS-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1cn(C(=O)OC(C)(C)C)cn1)C(=O)O |
| Storage condition | -15°C |
| Hazard Codes | T+ |
|---|---|
| HS Code | 2933290090 |
|
~%
Boc-His(Boc)-OH CAS#:20866-46-0 |
| Literature: US5217958 A1, ; |
|
~%
Boc-His(Boc)-OH CAS#:20866-46-0 |
| Literature: Bulletin des Societes Chimiques Belges, , vol. 99, # 10 p. 779 - 782 |
|
~%
Boc-His(Boc)-OH CAS#:20866-46-0 |
| Literature: Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), , # 7 p. 1205 - 1212 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-Histidine, N,1-bis[(1,1-dimethylethoxy)carbonyl]- |
| 1-(t-butoxycarbonyl)-N-(t-butoxycarbonyl)-L-histidine |
| MFCD00236850 |
| N,1-Bis-Boc-L-histidine |
| N,N'-Di-tert-butoxycarbonyl-L-histidine |
| N,1-Bis(tert-butoxycarbonyl)-L-histidine |
| Boc-L-His(Boc) |
| Boc-His(Boc)-OH |
| N,1-Bis{[(2-methyl-2-propanyl)oxy]carbonyl}-L-histidine |
| N,1'-bis[(1,1-dimethylethoxy)carbonyl]-L-histidine |
| Boc-His(Boc) |
| Boc-His(Boc)-OH.DCHA |
| (S)-3-(1-(tert-Butoxycarbonyl)-1H-imidazol-4-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid |