1H-Isoindole-1,3(2H)-dione,2-[(methylsulfonyl)oxy]- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-[(methylsulfonyl)oxy]- | ||
|---|---|---|---|---|
| CAS Number | 57212-70-1 | Molecular Weight | 241.22100 | |
| Density | 1.64g/cm3 | Boiling Point | 408.9ºC at 760mmHg | |
| Molecular Formula | C9H7NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.1ºC | |
| Name | (1,3-dioxoisoindol-2-yl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 408.9ºC at 760mmHg |
| Molecular Formula | C9H7NO5S |
| Molecular Weight | 241.22100 |
| Flash Point | 201.1ºC |
| Exact Mass | 241.00400 |
| PSA | 89.13000 |
| LogP | 1.19250 |
| Index of Refraction | 1.644 |
| InChIKey | MZVIAOIHWLOXPX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)ON1C(=O)c2ccccc2C1=O |
|
~%
1H-Isoindole-1,... CAS#:57212-70-1 |
| Literature: Kuehle; Wegler Justus Liebigs Annalen der Chemie, 1958 , vol. 616, p. 183,206 |
|
~%
1H-Isoindole-1,... CAS#:57212-70-1 |
| Literature: Chan; Lien; Tokes Journal of Medicinal Chemistry, 1987 , vol. 30, # 3 p. 509 - 514 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |
| N-methanesulfonyloxyphthalimide |
| N-Methansulfonyloxy-phthalimid |
| N-mesyloxyphthalimide |