(-)-Aminoglutethimide structure
|
Common Name | (-)-Aminoglutethimide | ||
|---|---|---|---|---|
| CAS Number | 57288-03-6 | Molecular Weight | 232.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of (-)-Aminoglutethimide(S)-Aminoglutethimide is an anticancer drug that belongs to the family of drugs called nonsteroidal aromatase inhibitors. Aminoglutethimide is used to decrease the production of sex hormones (estrogen in women or testosterone in men) and suppress the growth of tumors that need sex hormones to grow. |
| Name | (-)-3-(4-aminophenyl)-3-ethylpiperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16N2O2 |
|---|---|
| Molecular Weight | 232.27800 |
| Exact Mass | 232.12100 |
| PSA | 72.19000 |
| LogP | 2.26320 |
| InChIKey | ROBVIMPUHSLWNV-ZDUSSCGKSA-N |
| SMILES | CCC1(c2ccc(N)cc2)CCC(=O)NC1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
| (S)-(-)-Aminoglutethimide |
| MFCD03094024 |
| (-)-(S)-AMINOGLUTETHIMIDE |