MK-2295 structure
|
Common Name | MK-2295 | ||
|---|---|---|---|---|
| CAS Number | 573678-04-3 | Molecular Weight | 434.34 | |
| Density | 1.440±0.06 g/cm3(Predicted) | Boiling Point | 500.9±50.0 °C(Predicted) | |
| Molecular Formula | C21H12F6N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MK-2295MK-2295 (NGD-8243) is a TRPV1 antagonist. MK-2295 is an analgesic agent, and can be used for research of pain[1][2]. |
| Name | N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)pyridin-2-yl]quinazolin-4-amine |
|---|
| Description | MK-2295 (NGD-8243) is a TRPV1 antagonist. MK-2295 is an analgesic agent, and can be used for research of pain[1][2]. |
|---|---|
| Related Catalog | |
| Target |
TRPV1 |
| References |
| Density | 1.440±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 500.9±50.0 °C(Predicted) |
| Molecular Formula | C21H12F6N4 |
| Molecular Weight | 434.34 |
| InChIKey | VTANGSDRFFLTSQ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(Nc2ncnc3cc(-c4ncccc4C(F)(F)F)ccc23)cc1 |