(2,4,6-Trichlorophenoxy)acetic acid structure
|
Common Name | (2,4,6-Trichlorophenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 575-89-3 | Molecular Weight | 255.482 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 373.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H5Cl3O3 | Melting Point | 185℃ | |
| MSDS | N/A | Flash Point | 179.6±26.5 °C | |
| Name | 2-(2,4,6-trichlorophenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 373.4±37.0 °C at 760 mmHg |
| Melting Point | 185℃ |
| Molecular Formula | C8H5Cl3O3 |
| Molecular Weight | 255.482 |
| Flash Point | 179.6±26.5 °C |
| Exact Mass | 253.930420 |
| PSA | 46.53000 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | KZDCLQBOHGBWOI-UHFFFAOYSA-N |
| SMILES | O=C(O)COc1c(Cl)cc(Cl)cc1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Risk Phrases | 20/21/22-36/37/38-40 |
|---|---|
| Safety Phrases | 22-36/37/39 |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Solubility ratio ([HbS+drug (40 mM)]/[HbS-drug])
Source: ChEMBL
Target: N/A
External Id: CHEMBL634599
|
|
Name: Solubility ratio ([HbS+drug (5 mM)]/[HbS-drug])
Source: ChEMBL
Target: N/A
External Id: CHEMBL634600
|
|
Name: Solubility of Deoxyhemoglobin S (dHbS) concentration after addition dithionite as con...
Source: ChEMBL
Target: N/A
External Id: CHEMBL638278
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: Solubility of Haemoglobin S (HbS) concentration after addition of acid and dithionite
Source: ChEMBL
Target: N/A
External Id: CHEMBL638280
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Solubility ratio ([HbS+drug (10 mM)]/[HbS-drug])
Source: ChEMBL
Target: N/A
External Id: CHEMBL633104
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: Solubility ratio ([HbS+drug (20 mM)]/[HbS-drug]
Source: ChEMBL
Target: N/A
External Id: CHEMBL633105
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
| 2.4.6-Trichlor-phenylaetherglykolsaeure |
| (2,4,6-Trichlor-phenoxy)-essigsaeure |
| (2,4,6-Trichlorophenoxy)acetic acid |
| 2,4,6-TRICHLOROPHENOXYACETIC ACID |
| 2,3-DIHYDROBENZO[B][1,4]DIOXIN-5-YLCARBAMATE |
| EINECS 209-394-0 |
| Acetic acid,(2,4,6-trichlorophenoxy) |
| O-(2.4.6-Trichlor-phenyl)-glykolsaeure |