N6,2′-O-Dimethyladenosine structure
|
Common Name | N6,2′-O-Dimethyladenosine | ||
|---|---|---|---|---|
| CAS Number | 57817-83-1 | Molecular Weight | 295.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N6,2′-O-DimethyladenosineN6,2′-O-Dimethyladenosine, a substrate of fat mass and obesity-associated gene (FTO), is a reversible modification widely occurred on varied RNA molecules. N6,2′-O-Dimethyladenosine can regulate obesity[1][2]. |
| Name | N6,O2'-methyladenosine |
|---|---|
| Synonym | More Synonyms |
| Description | N6,2′-O-Dimethyladenosine, a substrate of fat mass and obesity-associated gene (FTO), is a reversible modification widely occurred on varied RNA molecules. N6,2′-O-Dimethyladenosine can regulate obesity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H17N5O4 |
|---|---|
| Molecular Weight | 295.29400 |
| Exact Mass | 295.12800 |
| PSA | 114.55000 |
| InChIKey | GRYSXUXXBDSYRT-WOUKDFQISA-N |
| SMILES | CNc1ncnc2c1ncn2C1OC(CO)C(O)C1OC |
| 2'-O-methyl-N6-methyladenosine |
| 6-N,2'-O-dimethyladenosine |
| N6,2'-O-Dimethyladenosine |
| N6,O2'-dimethyl-adenosine |