Benzoic acid,2,2'-iminobis- structure
|
Common Name | Benzoic acid,2,2'-iminobis- | ||
|---|---|---|---|---|
| CAS Number | 579-92-0 | Molecular Weight | 257.24100 | |
| Density | 1.424g/cm3 | Boiling Point | 467ºC at 760mmHg | |
| Molecular Formula | C14H11NO4 | Melting Point | 298ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 236.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,2'-iminodibenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 467ºC at 760mmHg |
| Melting Point | 298ºC (dec.)(lit.) |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24100 |
| Flash Point | 236.2ºC |
| Exact Mass | 257.06900 |
| PSA | 86.63000 |
| LogP | 2.89960 |
| Index of Refraction | 1.696 |
| InChIKey | ZFRNOTZQUGWMQN-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1ccccc1C(=O)O |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DH2960000 |
| HS Code | 2922499990 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| N-Cinnamoyl-o-tolylhydrorylamine |
| 2,2'-Azanediyldibenzoic acid |
| N-(2-carboxyphenyl)anthranilic acid |
| n-(o-carboxyphenyl)-anthranilicaci |
| Diphenylamine-2,2'-dicarboxyli |
| MFCD00012303 |
| vanadox |
| 2,2'-Iminobisbenzoic acid |
| diphenylamine-2,2'-dicarboxylic acid |
| 2,2'-diphenylaminedicarboxylicacid |
| 2-(2-carboxyanilino)benzoic acid |
| 2-[(2-carboxyphenyl)amino]benzoic acid |
| N-Cinnamoyl-o-tolylh |