Sorafenib N-Oxide structure
|
Common Name | Sorafenib N-Oxide | ||
|---|---|---|---|---|
| CAS Number | 583840-03-3 | Molecular Weight | 483.84300 | |
| Density | 1.455g/cm3 | Boiling Point | 591.655ºC at 760 mmHg | |
| Molecular Formula | C21H13ClD3F3N4O4 | Melting Point | 220-222ºC | |
| MSDS | N/A | Flash Point | 311.622ºC | |
Use of Sorafenib N-OxideSorafenib N-oxide is an active metabolite of sorafenib (BAY 43-9006), an inhibitor of Raf-1, B-RAF, and receptor tyrosine kinases. Sorafenib N-oxide inhibits FLT3 that contains the internal tandem duplication mutation (FLT3-ITD) and inhibits proliferation of MV4-11 acute myeloid leukemia (AML) cells expressing FLT3-ITD. It is selective for AML cell lines containing FLT3-ITD over lines containing wild-type FLT3. Sorafenib N-oxide is also a linear-mixed inhibitor of the cytochrome P450 (CYP) isoform CYP3A4. |
| Name | Sorafenib N-Oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 591.655ºC at 760 mmHg |
| Melting Point | 220-222ºC |
| Molecular Formula | C21H13ClD3F3N4O4 |
| Molecular Weight | 483.84300 |
| Flash Point | 311.622ºC |
| Exact Mass | 483.10000 |
| PSA | 104.92000 |
| LogP | 6.12010 |
| Index of Refraction | 1.601 |
| InChIKey | BQAZCCVUZDIZDC-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)cc[n+]1[O-] |
|
~55%
Sorafenib N-Oxide CAS#:583840-03-3 |
| Literature: BAYER CORPORATION Patent: US2003/216446 A1, 2003 ; US 20030216446 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methyl-1-oxidopyridin-1-ium-2-carboxamide |