2-Bromoterephthalic acid structure
|
Common Name | 2-Bromoterephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 586-35-6 | Molecular Weight | 245.027 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 421.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H5BrO4 | Melting Point | 295-297 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 208.7±27.3 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 2-Bromoterephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 421.6±40.0 °C at 760 mmHg |
| Melting Point | 295-297 °C(lit.) |
| Molecular Formula | C8H5BrO4 |
| Molecular Weight | 245.027 |
| Flash Point | 208.7±27.3 °C |
| Exact Mass | 243.937119 |
| PSA | 74.60000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | QPBGNSFASPVGTP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)O)c(Br)c1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic;Xi:Irritant; |
| Risk Phrases | R25;R36/37/38 |
| Safety Phrases | S26-S36-S45-S37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29173919 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 29173919 |
|---|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-bromo-1,4-dicarboxylic acid |
| 2-Bromoterephthalic acid |
| 2-Bromoterephthalicacid |
| EINECS 209-572-8 |
| 2-Bromo-1,4-benzenedicarboxylic acid |
| 2-BroMoterephthalic acid 25GR |
| MFCD00002403 |
| BROMOTEREPHTHALIC ACID |
| 2-fluoro-1,4-benzendicarboxylic acid |
| 2-bromobenzene-1,4-dicarboxylic acid |