2-Bromoterephthalic acid
2-Bromoterephthalic acid structure
|
Common Name | 2-Bromoterephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 586-35-6 | Molecular Weight | 245.027 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 421.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H5BrO4 | Melting Point | 295-297 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 208.7±27.3 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Bromoterephthalic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 421.6±40.0 °C at 760 mmHg |
| Melting Point | 295-297 °C(lit.) |
| Molecular Formula | C8H5BrO4 |
| Molecular Weight | 245.027 |
| Flash Point | 208.7±27.3 °C |
| Exact Mass | 243.937119 |
| PSA | 74.60000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | QPBGNSFASPVGTP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(=O)O)c(Br)c1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic;Xi:Irritant; |
| Risk Phrases | R25;R36/37/38 |
| Safety Phrases | S26-S36-S45-S37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29173919 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 10 | |
CAS#:553-94-6
CAS#:90001-43-7
CAS#:871876-77-6
CAS#:99-94-5
CAS#:108-95-2
CAS#:7697-26-9
CAS#:10312-55-7
CAS#:18870-13-8
CAS#:7664-93-9![9-[2,5-bis(chloromethyl)phenyl]carbazole structure](https://image.chemsrc.com/caspic/098/214621-81-5.png)
CAS#:214621-81-5
CAS#:25539-20-2
CAS#:30240-01-8
CAS#:6342-72-9
CAS#:636-94-2
CAS#:10035-10-6![2-[2,5-bis(chloromethyl)phenyl]-9,9-dihexylfluorene structure](https://image.chemsrc.com/caspic/016/311768-09-9.png)
CAS#:311768-09-9
CAS#:13815-89-9
CAS#:18643-86-2
CAS#:1186377-08-1This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 29173919 |
|---|
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-bromo-1,4-dicarboxylic acid |
| 2-Bromoterephthalic acid |
| 2-Bromoterephthalicacid |
| EINECS 209-572-8 |
| 2-Bromo-1,4-benzenedicarboxylic acid |
| 2-BroMoterephthalic acid 25GR |
| MFCD00002403 |
| BROMOTEREPHTHALIC ACID |
| 2-fluoro-1,4-benzendicarboxylic acid |
| 2-bromobenzene-1,4-dicarboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2-Bromoterephthalic acid? |
| A: Boiling point of 2-Bromoterephthalic acid is 421.6±40.0 °C at 760 mmHg. |
| Q: What is the CAS number of 2-Bromoterephthalic acid? |
| A: CAS number of 2-Bromoterephthalic acid is 586-35-6. |
| Q: What is the molecular formula of 2-Bromoterephthalic acid? |
| A: Molecular formula of 2-Bromoterephthalic acid is C8H5BrO4. |
| Q: What is the English name of 2-Bromoterephthalic acid? |
| A: The English name of 2-Bromoterephthalic acid is 2-Bromoterephthalic acid. |
| Q: What are the downstream products of 2-Bromoterephthalic acid? |
| A: Related downstream products(CAS) of 2-Bromoterephthalic acid: 214621-81-5;25539-20-2;30240-01-8;6342-72-9;636-94-2;10035-10-6;311768-09-9;13815-89-9;18643-86-2;1186377-08-1. |
| Q: What is the safety information for 2-Bromoterephthalic acid? |
| A: Safety information for 2-Bromoterephthalic acid: S26-S36-S45-S37/39. |
| Q: What is the InChIKey of 2-Bromoterephthalic acid? |
| A: InChIKey of 2-Bromoterephthalic acid is QPBGNSFASPVGTP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-Bromoterephthalic acid? |
| A: Polar surface area (PSA) of 2-Bromoterephthalic acid is 74.60000. |
| Q: What is the melting point of 2-Bromoterephthalic acid? |
| A: Melting point of 2-Bromoterephthalic acid is 295-297 °C(lit.). |
| Q: What is the molecular weight of 2-Bromoterephthalic acid? |
| A: Molecular weight of 2-Bromoterephthalic acid is 245.027. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |