3-(4-cyclohexylbenzoyl)acrylic acid structure
|
Common Name | 3-(4-cyclohexylbenzoyl)acrylic acid | ||
|---|---|---|---|---|
| CAS Number | 58897-74-8 | Molecular Weight | 258.31200 | |
| Density | 1.156g/cm3 | Boiling Point | 437.6ºC at 760 mmHg | |
| Molecular Formula | C16H18O3 | Melting Point | 140-142ºC | |
| MSDS | N/A | Flash Point | 232.6ºC | |
| Name | (E)-4-(4-cyclohexylphenyl)-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 437.6ºC at 760 mmHg |
| Melting Point | 140-142ºC |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.31200 |
| Flash Point | 232.6ºC |
| Exact Mass | 258.12600 |
| PSA | 54.37000 |
| LogP | 3.55780 |
| Index of Refraction | 1.567 |
| InChIKey | YJJOPFUDTMESJU-ZHACJKMWSA-N |
| SMILES | O=C(O)C=CC(=O)c1ccc(C2CCCCC2)cc1 |
|
~61%
3-(4-cyclohexyl... CAS#:58897-74-8 |
| Literature: Kameo; Asami; Ogawa; Matsunaga; Saito; Tomisawa; Sota Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1260 - 1267 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| hms1452p15 |