Albaspidin AP structure
|
Common Name | Albaspidin AP | ||
|---|---|---|---|---|
| CAS Number | 59092-91-0 | Molecular Weight | 470.956 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 434.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H7Cl4F8NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.5±28.7 °C | |
Use of Albaspidin APAlbaspidin AP inhibits fatty acid synthase (FAS) with an IC50 value of 71.7 μM. Fatty acid synthase (FAS) is emerging as a potential therapeutic target for cancer and obesity[1]. |
| Name | 1,7-dichloro-2,6-bis(chloro(difluoro)methyl)-1,1,7,7-tetrafluoro-2,6-dihydroxy-4-heptanone oxime |
|---|---|
| Synonym | More Synonyms |
| Description | Albaspidin AP inhibits fatty acid synthase (FAS) with an IC50 value of 71.7 μM. Fatty acid synthase (FAS) is emerging as a potential therapeutic target for cancer and obesity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.4±45.0 °C at 760 mmHg |
| Molecular Formula | C9H7Cl4F8NO3 |
| Molecular Weight | 470.956 |
| Flash Point | 216.5±28.7 °C |
| Exact Mass | 468.905243 |
| LogP | 10.44 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.439 |
| InChIKey | KINDGCLGBSBXOD-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(O)C(CC2=C(O)C(C)(C)C(=O)C(C(C)=O)=C2O)=C(O)C(C)(C)C1=O |
| 1,7-dichloro-2,6-bis(chloro(difluoro)methyl)-1,1,7,7-tetrafluoro-2,6-dihydroxy-4-heptanone oxime |
| 4-Heptanone, 2,6-bis(chlorodifluoromethyl)-1,7-dichloro-2,6-dihydroxy-1,1,7,7-tetrafluoro-, oxime |
| 1,7-Dichloro-2,6-bis[chloro(difluoro)methyl]-1,1,7,7-tetrafluoro-4-(hydroxyimino)-2,6-heptanediol |
| 4-Heptanone, 1,7-dichloro-2,6-bis(chlorodifluoromethyl)-1,1,7,7-tetrafluoro-2,6-dihydroxy-, oxime |
| Albaspidin AP |