Di(N-succinimidyl)adipate structure
|
Common Name | Di(N-succinimidyl)adipate | ||
|---|---|---|---|---|
| CAS Number | 59156-70-6 | Molecular Weight | 340.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Di(N-succinimidyl)adipateDi(N-succinimidyl)adipate is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | bis(2,5-dioxopyrrolidin-1-yl) hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Description | Di(N-succinimidyl)adipate is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H16N2O8 |
|---|---|
| Molecular Weight | 340.28500 |
| Exact Mass | 340.09100 |
| PSA | 127.36000 |
| InChIKey | LZZXZDMVRZJZST-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
|
~91%
Di(N-succinimid... CAS#:59156-70-6 |
| Literature: Mishra, Narendra Kumar; Joshi, Khashti Ballabh; Verma, Sandeep Molecular Pharmaceutics, 2013 , vol. 10, # 10 p. 3903 - 3912 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| adipic acid di-N-hydroxysuccinimide ester |
| di-(N-hydroxysuccinimidyl) adipate ester |
| bis(N-hydroxysuccinimidyl) adipate |
| disuccinimidyl adipate |
| bis(N-hydroxysuccinimidyl) adipic acid diester |
| Di(N-succinimidyl) adipate |
| adipic acid bis(succinimidyl) ester |
| 2,5-Pyrrolidinedione,1,1'-[(1,6-dioxo-1,6-hexanediyl)bis(oxy)]bis |