H-Arg-Gly-Tyr-Ala-Leu-Gly-OH structure
|
Common Name | H-Arg-Gly-Tyr-Ala-Leu-Gly-OH | ||
|---|---|---|---|---|
| CAS Number | 59587-24-5 | Molecular Weight | 635.71200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H45N9O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Arg-Gly-Tyr-Ala-Leu-Gly-OHH-Arg-Gly-Tyr-Ala-Leu-Gly-OH is a competitive and CAMP dependent protein kinase inhibitor[1]. |
| Name | H-Arg-Gly-Tyr-Ala-Leu-Gly-OH |
|---|---|
| Synonym | More Synonyms |
| Description | H-Arg-Gly-Tyr-Ala-Leu-Gly-OH is a competitive and CAMP dependent protein kinase inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H45N9O8 |
|---|---|
| Molecular Weight | 635.71200 |
| Exact Mass | 635.33900 |
| PSA | 290.95000 |
| LogP | 1.20840 |
| InChIKey | RPAKYHDUWYQJQN-FIRPJDEBSA-N |
| SMILES | CC(C)CC(NC(=O)C(C)NC(=O)C(Cc1ccc(O)cc1)NC(=O)CNC(=O)C(N)CCCN=C(N)N)C(=O)NCC(=O)O |
| rgyalg |
| arg-gly-tyr-ala-leu-gly |