Acetamide,N-(2-methyl-6-nitrophenyl)- structure
|
Common Name | Acetamide,N-(2-methyl-6-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 59907-22-1 | Molecular Weight | 194.18700 | |
| Density | 1.289g/cm3 | Boiling Point | 375.3ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.8ºC | |
| Name | N-(2-methyl-6-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 375.3ºC at 760 mmHg |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.18700 |
| Flash Point | 180.8ºC |
| Exact Mass | 194.06900 |
| PSA | 74.92000 |
| LogP | 2.45780 |
| Index of Refraction | 1.605 |
| InChIKey | VWGWKZKGMNQBIK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c(C)cccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Essigsaeure-(2-methyl-6-nitro-anilid) |
| 2-methyl-6-nitroacetanilide |
| 6'-nitro-o-acetotoluidide |
| acetic acid-(2-methyl-6-nitro-anilide) |
| 3-Nitro-2-acetamino-toluol |
| N-(2-Methyl-6-nitro-phenyl)-acetamide |
| 6'-Nitro-ortho-acetotoluidide |