Glabrone structure
|
Common Name | Glabrone | ||
|---|---|---|---|---|
| CAS Number | 60008-02-8 | Molecular Weight | 336.33800 | |
| Density | 1.368g/cm3 | Boiling Point | 554.1ºC at 760 mmHg | |
| Molecular Formula | C20H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.6ºC | |
Use of GlabroneGlabrone is an isoflavone isolated from Glycyrrhiza glabra roots. Glabrone exhibits anti-influenza activity and significant PPAR-γ ligand-binding activity[1][2]. |
| Name | 7-hydroxy-3-(5-hydroxy-2,2-dimethylchromen-6-yl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Glabrone is an isoflavone isolated from Glycyrrhiza glabra roots. Glabrone exhibits anti-influenza activity and significant PPAR-γ ligand-binding activity[1][2]. |
|---|---|
| Related Catalog | |
| Target |
PPAR-γ |
| References |
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 554.1ºC at 760 mmHg |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.33800 |
| Flash Point | 202.6ºC |
| Exact Mass | 336.10000 |
| PSA | 79.90000 |
| LogP | 4.05540 |
| Index of Refraction | 1.659 |
| InChIKey | COLMVFWKLOZOOP-UHFFFAOYSA-N |
| SMILES | CC1(C)C=Cc2c(ccc(-c3coc4cc(O)ccc4c3=O)c2O)O1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914400090 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 7,5'-dihydroxy-2',2'-dimethyl-2'H-[3,6']bichromenyl-4-one |
| Morusin hydroperoxide |
| 4H-1-Benzopyran-4-one,7-hydroxy-3-(5-hydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl) |
| Glabrone |
| HMS2268B14 |