9,10-Anthracenedione,2,7-dichloro- structure
|
Common Name | 9,10-Anthracenedione,2,7-dichloro- | ||
|---|---|---|---|---|
| CAS Number | 605-43-6 | Molecular Weight | 277.10200 | |
| Density | 1.514g/cm3 | Boiling Point | 455.2ºC at 760 mmHg | |
| Molecular Formula | C14H6Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.7ºC | |
| Name | 2,7-dichloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.514g/cm3 |
|---|---|
| Boiling Point | 455.2ºC at 760 mmHg |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | 277.10200 |
| Flash Point | 191.7ºC |
| Exact Mass | 275.97400 |
| PSA | 34.14000 |
| LogP | 3.76880 |
| Index of Refraction | 1.671 |
| InChIKey | HQUNBWGQFXPVES-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc(Cl)cc2C(=O)c2cc(Cl)ccc21 |
|
~%
9,10-Anthracene... CAS#:605-43-6 |
| Literature: Hoechster Farbw. Patent: DE284976 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 409 |
|
~%
9,10-Anthracene... CAS#:605-43-6 |
| Literature: Atack; Clough Patent: GB169732 , 1920 ; |
|
~%
9,10-Anthracene... CAS#:605-43-6 |
| Literature: Hayashi; Nakayama Kogyo Kagaku Zasshi, Spl. 37 <1934> 238 |
|
~%
9,10-Anthracene... CAS#:605-43-6 |
| Literature: Bad. Anilin- u. Sodaf. Patent: DE197554 ; |
|
~%
9,10-Anthracene... CAS#:605-43-6 |
| Literature: Jones; Mason Journal of the Chemical Society, 1934 , p. 1813,1815 |
|
~%
9,10-Anthracene... CAS#:605-43-6 |
| Literature: Atack; Clough Patent: GB169732 , 1920 ; |
|
~%
9,10-Anthracene... CAS#:605-43-6 |
| Literature: Lauer Journal fuer Praktische Chemie (Leipzig), 1933 , vol. <2> 136, p. 1,2, 4 |
| 2,7-Dichloroanthraquinone |
| 2,7-Dichlor-anthrachinon |
| 2,7-dichloro-9,10-anthraquinone |
| 2,7-dichloro-9,10-anthracenedione |
| 9,2,7-dichloro |