1-Bromo-2-methyl-4-nitrobenzene structure
|
Common Name | 1-Bromo-2-methyl-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 7149-70-4 | Molecular Weight | 216.032 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 278.0±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H6BrNO2 | Melting Point | 78-80 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 121.9±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Bromo-5-nitrotoluene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 278.0±20.0 °C at 760 mmHg |
| Melting Point | 78-80 °C(lit.) |
| Molecular Formula | C7H6BrNO2 |
| Molecular Weight | 216.032 |
| Flash Point | 121.9±21.8 °C |
| Exact Mass | 214.958176 |
| PSA | 45.82000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | HIMGPQVBNICCGL-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])ccc1Br |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Packaging Group | II |
| HS Code | 2904909090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Dimorphs of 4'-amino-4-hydroxy-2'-methylbiphenyl: Assessment of likelihood of polymorphism in flexible molecules. Dey A and Desiraju GR.
CrystEngComm 8(6) , 477-481, (2006)
|
|
|
16. Substitution in the methyl-4'-nitro-and-4'-acetamido-diphenyl ethers. Scarborough HA and Sweeten JL.
J. Chem. Soc. , 52-56, (1934)
|
| Benzene, 1-bromo-2-methyl-4-nitro- |
| 4-bromo-3-methylnitrobenzene |
| MFCD00007281 |
| 1-bromo-2-methyl-4-nitrobenzene |
| 2-BROMO-5-NITROTOLUENE |
| EINECS 230-481-4 |