O-Desmethyl galanthamine structure
|
Common Name | O-Desmethyl galanthamine | ||
|---|---|---|---|---|
| CAS Number | 60755-80-8 | Molecular Weight | 273.32700 | |
| Density | 1.37g/cm3 | Boiling Point | 451.9ºC at 760 mmHg | |
| Molecular Formula | C16H19NO3 | Melting Point | 227-230ºC (dec.) | |
| MSDS | N/A | Flash Point | 227.1ºC | |
Use of O-Desmethyl galanthamineO-Desmethyl Galanthamine (Sanguinine) is galanthamine-type alkaloid. O-Desmethyl Galanthamine is an acetylcholinesterase (AChE) inhibitor, with an IC50 1.83 μM[1]. |
| Name | Sanguinine |
|---|---|
| Synonym | More Synonyms |
| Description | O-Desmethyl Galanthamine (Sanguinine) is galanthamine-type alkaloid. O-Desmethyl Galanthamine is an acetylcholinesterase (AChE) inhibitor, with an IC50 1.83 μM[1]. |
|---|---|
| Related Catalog | |
| Target |
AChE[1] |
| References |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 451.9ºC at 760 mmHg |
| Melting Point | 227-230ºC (dec.) |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.32700 |
| Flash Point | 227.1ºC |
| Exact Mass | 273.13600 |
| PSA | 52.93000 |
| LogP | 1.48520 |
| Index of Refraction | 1.683 |
| InChIKey | OYSGWKOGUVOGFQ-RBOXIYTFSA-N |
| SMILES | CN1CCC23C=CC(O)CC2Oc2c(O)ccc(c23)C1 |
| O-Desmethylgalantamine |
| UNII-L7ZOW3CZ7W |
| 6-demethylgalanthamine |
| O-Desmethyl Galanthamine |
| O-Demethylgalanthamine |
| O-Demethylgalantamine |