1-[4-[(4-chlorophenyl)methoxy]phenyl]ethanone structure
|
Common Name | 1-[4-[(4-chlorophenyl)methoxy]phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 61035-74-3 | Molecular Weight | 260.71600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-[(4-chlorophenyl)methoxy]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13ClO2 |
|---|---|
| Molecular Weight | 260.71600 |
| Exact Mass | 260.06000 |
| PSA | 26.30000 |
| LogP | 4.12160 |
| InChIKey | FSWVMYKVMVKHDH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCc2ccc(Cl)cc2)cc1 |
|
~95%
1-[4-[(4-chloro... CAS#:61035-74-3 |
| Literature: Kawamatsu; Sohda; Iami European Journal of Medicinal Chemistry, 1981 , vol. 16, # 4 p. 355 - 362 |
|
~%
1-[4-[(4-chloro... CAS#:61035-74-3 |
| Literature: Kim, Jinyoung; Kim, Ki-Sun; Lee, Hyo Seon; Park, Kwang-Su; Park, Sun Young; Kang, Seock-Yong; Lee, Soo Jae; Park, Hyung Soon; Kim, Dong-Eun; Chong, Youhoon Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 16 p. 4661 - 4665 |
| 4-(4-Chlorbenzyloxy)acetophenon |
| 4-(4-chlorobenzyloxy)acetophenone |
| 1-{4-[(4-chlorophenyl)methoxy]phenyl}ethanone |
| 1-acetyl-4-[(4-chlorophenyl)methoxy]benzene |
| 1-(4-[(4-Chlorobenzyl)oxy]phenyl)ethanone |