1-(4'-CHLORO-BIPHENYL-4-YL)-ETHANONE structure
|
Common Name | 1-(4'-CHLORO-BIPHENYL-4-YL)-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 5002-07-3 | Molecular Weight | 230.69000 | |
| Density | 1.163g/cm3 | Boiling Point | 353.2ºC at 760mmHg | |
| Molecular Formula | C14H11ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.2ºC | |
| Name | 1-[4-(4-chlorophenyl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 353.2ºC at 760mmHg |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.69000 |
| Flash Point | 193.2ºC |
| Exact Mass | 230.05000 |
| PSA | 17.07000 |
| LogP | 4.20960 |
| Index of Refraction | 1.577 |
| InChIKey | NPGUSEJJJVVVME-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-acetyl-4'-chlorobiphenyl |
| 4-acetyl-4'-chloro-1,1'-biphenyl |