Temocillin disodium salt
Modify Date: 2025-08-25 11:11:28
Temocillin disodium salt structure
|
Common Name | Temocillin disodium salt | ||
|---|---|---|---|---|
| CAS Number | 61545-06-0 | Molecular Weight | 458.42 | |
| Density | 1.6g/cm3 | Boiling Point | 761.9ºC at 760mmHg | |
| Molecular Formula | C16H16N2Na2O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 414.6ºC | |
Use of Temocillin disodium saltTemocillin disodium, a 6-α-methoxy penicillin, possesses antibacterial activity[1]. |
| Name | temocillin disodium |
|---|---|
| Synonym | More Synonyms |
| Description | Temocillin disodium, a 6-α-methoxy penicillin, possesses antibacterial activity[1]. |
|---|---|
| Related Catalog | |
| In Vivo | Temocillin dosing regimens of 200 mg/kg every 4 and 6 h remained significantly effective in reducing bacterial titres in kidneys against the two strains, with no significant difference between the parental strain and its transconjugant[2]. |
| References |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 761.9ºC at 760mmHg |
| Molecular Formula | C16H16N2Na2O7S2 |
| Molecular Weight | 458.42 |
| Flash Point | 414.6ºC |
| Exact Mass | 414.05600 |
| PSA | 190.27000 |
| LogP | 1.30030 |
| InChIKey | MRGCZDWBFFUEES-CWBCWDDISA-L |
| SMILES | COC1(NC(=O)C(C(=O)[O-])c2ccsc2)C(=O)N2C(C(=O)[O-])C(C)(C)SC21.[Na+].[Na+] |
| 4-Thia-1-azabicyclo(3.2.0)heptane-2-carboxylic acid,6-((carboxy-3-thienylacetyl)amino)-6-methoxy-3,3-dimethyl-7-oxo-,disodium salt,(2S,5R,6S) |
| disodium,(2S,5R,6S)-6-[(2-carboxylato-2-thiophen-3-ylacetyl)amino]-6-methoxy-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| UNII-96IIP39ODH |
| Negaban (TN) |
| Temocillin disodium salt |
| EINECS 262-835-9 |
| Temocillin sodium |
| Temocillin |