Ethyl 2-benzylidene-3-oxobutanoate structure
|
Common Name | Ethyl 2-benzylidene-3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 620-80-4 | Molecular Weight | 218.249 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 296.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.9±18.2 °C | |
| Name | Ethyl2-benzylideneacetoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.0±0.0 °C at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.249 |
| Flash Point | 111.9±18.2 °C |
| Exact Mass | 218.094299 |
| PSA | 43.37000 |
| LogP | 2.21 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | AYZGINZXVVKWKV-FMIVXFBMSA-N |
| SMILES | CCOC(=O)C(=Cc1ccccc1)C(C)=O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl (2Z)-2-benzylidene-3-oxobutanoate |
| Ethyl 2-benzylideneacetoacetate |
| 2-Acetyl-3-phenylpropenoic acid ethyl ester |
| ethyl 2-benzylidene-3-oxobutanoate |
| 2-Benzylidene-3-oxobutanoic acid ethyl ester |
| 2-Acetyl-3-phenylacrylic acid ethyl ester |
| ethyl acetobenzylidene acetate |
| Ethyl (2E)-2-benzylidene-3-oxobutanoate |
| 2-Benzylidene-3-oxobutyric acid ethyl ester |
| 2-benzylideneacetoacetic acid ethyl ester |