Urea,N,N'-bis(4-methylphenyl)- structure
|
Common Name | Urea,N,N'-bis(4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 621-00-1 | Molecular Weight | 240.30000 | |
| Density | 1.187g/cm3 | Boiling Point | 298.6ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97ºC | |
| Name | 1,3-bis(4-methylphenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 298.6ºC at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 97ºC |
| Exact Mass | 240.12600 |
| PSA | 41.13000 |
| LogP | 4.09340 |
| Index of Refraction | 1.66 |
| InChIKey | HIIZOYBOCSCLPH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(C)cc2)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-di(p-tolyl)urea |
| n,n'-di(4-methylphenyl)urea |
| Urea,N,N'-bis(4-methylphenyl) |
| F0034-0127 |
| 1,3-di(4-methylphenyl)urea |
| 1,3-di(para-tolyl)urea |
| Urea,N'-bis(4-methylphenyl) |
| 1,3-di-p-tolylcarbamide |
| 1,3-Di-p-tolylurea |
| 4,4'-Ditolylurea |
| N-(4-methylphenyl)[(4-methylphenyl)amino]carboxamide |
| N,N'-bis(4-methylphenyl)urea |