N-Phthaloylglycine structure
|
Common Name | N-Phthaloylglycine | ||
|---|---|---|---|---|
| CAS Number | 6296-53-3 | Molecular Weight | 205.167 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 489.1±28.0 °C at 760 mmHg | |
| Molecular Formula | C10H7NO4 | Melting Point | 186 °C | |
| MSDS | N/A | Flash Point | 249.6±24.0 °C | |
| Name | AcetaMide,N-(1,3-dihydro-1,3-dioxo-4-isobenzofuranyl) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.1±28.0 °C at 760 mmHg |
| Melting Point | 186 °C |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.167 |
| Flash Point | 249.6±24.0 °C |
| Exact Mass | 205.037506 |
| PSA | 72.47000 |
| LogP | 0.46 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | PAUAJOABXCGLCN-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc2c1C(=O)OC2=O |
|
~61%
N-Phthaloylglycine CAS#:6296-53-3 |
| Literature: CELGENE CORPORATION; ADAMS, Mary; STEVENS, Randall; SCHAFER, Peter, H. Patent: WO2014/74846 A1, 2014 ; Location in patent: Page/Page column 20; 21 ; |
|
~%
N-Phthaloylglycine CAS#:6296-53-3 |
| Literature: US2003/187052 A1, ; |
|
~%
N-Phthaloylglycine CAS#:6296-53-3 |
| Literature: Journal of the American Chemical Society, , vol. 31, p. 489 |
|
~%
N-Phthaloylglycine CAS#:6296-53-3 |
| Literature: Journal of the American Chemical Society, , vol. 31, p. 489 |
|
~%
N-Phthaloylglycine CAS#:6296-53-3 |
| Literature: Annales Pharmaceutiques Francaises, , vol. 16, p. 421,425 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| Acetamide, N-(1,3-dihydro-1,3-dioxo-4-isobenzofuranyl)- |
| 3-acetylaminophthalic anhydride |
| 3-AcetylaMino-phthalsaeure-anhydrid |
| N-Phthaloylglycine |
| 2H-Isoindole-2-acetic acid, 1,3-dihydro-1,3-dioxo- |
| 3-acetamidophthalic anhydride |
| 3-acetylamino-phthalic acid-anhydride |
| N-(1,3-Dihydro-1,3-dioxoisobenzofuran-4-yl)acetamide |
| N-(1,3-Dioxo-1,3-dihydro-2-benzofuran-4-yl)acetamide |
| (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid |
| 3-acetaminophthalic anhydride |
| 3-acetamidopthalic anhydride |
| N-(1,3-Dioxo-1,3-dihydro-isobenzofuran-4-yl)-acetamide |