Cortodoxone structure
|
Common Name | Cortodoxone | ||
|---|---|---|---|---|
| CAS Number | 152-58-9 | Molecular Weight | 346.461 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 524.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H30O4 | Melting Point | 205-208 °C | |
| MSDS | USA | Flash Point | 285.1±26.6 °C | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
| Name | 11-deoxycortisol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 524.5±50.0 °C at 760 mmHg |
| Melting Point | 205-208 °C |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.461 |
| Flash Point | 285.1±26.6 °C |
| Exact Mass | 346.214417 |
| PSA | 74.60000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | WHBHBVVOGNECLV-OBQKJFGGSA-N |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C1CCC2(O)C(=O)CO |
| Storage condition | -20°C Freezer |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | F,T |
| Risk Phrases | R22;R24/25 |
| Safety Phrases | S24/25-S22 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| RTECS | TU5011500 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Calculating virtual log P in the alkane/water system (log P(N)(alk)) and its derived parameters deltalog P(N)(oct-alk) and log D(pH)(alk).
J. Med. Chem. 48 , 3269-79, (2005) Growing interest in the use of both the logarithm of the partition coefficient of the neutral species in the alkane/water system (log P(N)(alk)) and the difference between log P(N)(oct) (the logarithm... |
|
|
Chemical genetics reveals a complex functional ground state of neural stem cells.
Nat. Chem. Biol. 3(5) , 268-273, (2007) The identification of self-renewing and multipotent neural stem cells (NSCs) in the mammalian brain holds promise for the treatment of neurological diseases and has yielded new insight into brain canc... |
|
|
An updated steroid benchmark set and its application in the discovery of novel nanomolar ligands of sex hormone-binding globulin.
J. Med. Chem. 51 , 2047-56, (2008) A benchmark data set of steroids with known affinity for sex hormone-binding globulin (SHBG) has been widely used to validate popular molecular field-based QSAR techniques. We have expanded the data s... |
|
Name: Inhibition of neurosphere proliferation of mouse neural precursor cells by MTT assay
Source: ChEMBL
Target: N/A
External Id: CHEMBL1266185
|
|
Name: Primary qHTS assay for inhibitors of alpha-synuclein gene (SNCA) expression
Source: NCGC
External Id: SNCA-p-activity-luciferase
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Cytochrome P450 Family 1 Subfamily A Member 2 (CYP1A2) small molecule antagonists: lu...
Source: 824
External Id: CYP273
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: qHTS Assay for Small Molecule Inhibitors of the Human hERG Channel Activity
Source: NCGC
External Id: HERG01
|
|
Name: Permeability of the compound in PBS and EtOH by PAMPA method
Source: ChEMBL
Target: N/A
External Id: CHEMBL3412995
|
|
Name: qHTS for Inhibitors of TGF-b: Cytotox Counterscreen
Source: NCGC
Target: N/A
External Id: SMAD3201
|
|
Name: uHTS identification of cystic fibrosis induced NFkb Inhibitors in a fluoresence assay
Source: Burnham Center for Chemical Genomics
Target: cystic fibrosis transmembrane conductance regulator [Homo sapiens]
External Id: SBCCG-A764-CF-PAF-Primary-Assay
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ant...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_ANT_FLUO8_1536_1X%INH PRUN
|
| 11-deoxy-17-hydroxy-Corticosterone |
| CORTEXOLONE |
| 17-Hydroxy-11-desoxy-corticosterone |
| SK&F 3050 |
| 4-Pregnene-17α,21-diol-3,20-dione |
| 17-(1-Keto-2-hydroxyethyl)-4-androsten-17a-ol-3-one |
| 11-Deoxycortisol |
| 11-deoxy-Cortisol |
| 17α,21-Dihydroxy-4-pregnene-3,20-dione |
| 11-dioxy-cortiso |
| Reichstein S |
| 17,21-Dihydroxyprogesterone |
| 17,21-Dihydroxypregn-4-ene-3,20-dione |
| Reichstein's substance S |
| 11-Desoxycortisone |
| Cortodoxone |
| 11-Desoxycortisol |
| Reichstein's "Substance S" |
| 17-Hydroxy-11-deoxycorticosterone |
| 4-Pregnene-17a,21-diol-3,20-dione |
| 17,21-Dihydroxy-4-pregnene-3,20-dione |
| 11-Deoxy-17-hydroxycorticosterone |
| 17-hydroxydesoxycorticosterone |
| 11-dioxycortisol |
| EINECS 205-805-2 |
| 17,21-Dihydroxy-pregn-4-ene-3,20-dione |
| skf3050 |
| MFCD00003662 |