tetraethyl 1,1,2,2-ethanetetracarboxylate structure
|
Common Name | tetraethyl 1,1,2,2-ethanetetracarboxylate | ||
|---|---|---|---|---|
| CAS Number | 632-56-4 | Molecular Weight | 318.32000 | |
| Density | 1.163g/cm3 | Boiling Point | 377.238ºC at 760 mmHg | |
| Molecular Formula | C14H22O8 | Melting Point | 73-75ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 162.552ºC | |
| Name | tetraethyl ethane-1,1,2,2-tetracarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 377.238ºC at 760 mmHg |
| Melting Point | 73-75ºC(lit.) |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32000 |
| Flash Point | 162.552ºC |
| Exact Mass | 318.13100 |
| PSA | 105.20000 |
| LogP | 0.47120 |
| Index of Refraction | 1.453 |
| InChIKey | UQSBVZIXVVORQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C(=O)OCC)C(=O)OCC |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917190090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Dicopper (II) and dicopper (III) complexes with a double-ring octa-aza macrocycle. Buttafava A, et al.
J. Chem. Soc. Chem. Commun. 20 , 1166-1167, (1982)
|
|
|
A superoxide dismutase mimic with high activity: crystal structure, solution equilibrium and pulse radiolysis.
J. Chem. Soc., Dalton Trans. 12 , 1893-1900, (2000)
|
| 1,1,2,2-Tetracarbethoxyethane |
| diethyl 2,3-bis(ethoxycarbonyl)succinate |
| Tetraethyl 1,1,2,2-ethanetetracarboxylate |
| 1,1,2,2-tetrakis(ethoxycarbonyl)ethane |
| diethyl 2,3-diethoxycarbonylsuccinate |
| MFCD00009153 |
| tetraethyl-1,1,2,2-ethanecarboxylate |
| EINECS 211-180-7 |
| 1,1,2,2-Ethanetetracarboxylic acid,tetraethyl ester |