Benzenesulfonamide, 2,5-dichloro-N-methyl- structure
|
Common Name | Benzenesulfonamide, 2,5-dichloro-N-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6326-15-4 | Molecular Weight | 240.10700 | |
| Density | 1.464g/cm3 | Boiling Point | 356.3ºC at 760mmHg | |
| Molecular Formula | C7H7Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.3ºC | |
| Name | 2,5-dichloro-N-methylbenzenesulfonamide |
|---|
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 356.3ºC at 760mmHg |
| Molecular Formula | C7H7Cl2NO2S |
| Molecular Weight | 240.10700 |
| Flash Point | 169.3ºC |
| Exact Mass | 238.95700 |
| PSA | 54.55000 |
| LogP | 3.37320 |
| Index of Refraction | 1.566 |
| InChIKey | GGMKUYAJGXCRTE-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)c1cc(Cl)ccc1Cl |
|
~80%
Benzenesulfonam... CAS#:6326-15-4 |
| Literature: El-Sharief, A. M. Sh.; Ammar, M. S.; Ammar, Y. A.; Zaki, M. E. A. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 7 p. 700 - 704 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |