2,3-Dibromo-9,10-anthraquinone structure
|
Common Name | 2,3-Dibromo-9,10-anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 633-68-1 | Molecular Weight | 366.004 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 491.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H6Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2±15.3 °C | |
| Name | 2,3-dibromoanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 491.8±45.0 °C at 760 mmHg |
| Molecular Formula | C14H6Br2O2 |
| Molecular Weight | 366.004 |
| Flash Point | 172.2±15.3 °C |
| Exact Mass | 363.873444 |
| PSA | 34.14000 |
| LogP | 4.79 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | RECQBTCMRZKCQX-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2cc(Br)c(Br)cc21 |
| HS Code | 2914700090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 9,10-Anthracenedione,2,3-dibromo |
| 2,3-Dibromo-9,10-anthraquinone |
| 2,3-dibromo-anthraquinone |
| 2,3,5,6-TETRAHYDROXYBENZO-1,4-QUINONE |
| 2,3-DIBROMO-9,10-ANTHRACENEDIONE |
| 2,3-Dibrom-anthrachinon |
| QC-7275 |
| 9,10-Anthracenedione, 2,3-dibromo- |