8-CPT-2Me-cAMP sodium structure
|
Common Name | 8-CPT-2Me-cAMP sodium | ||
|---|---|---|---|---|
| CAS Number | 634207-53-7 | Molecular Weight | 525.83600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16ClN5NaO6PS | Melting Point | 235.5-237.5 ℃(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of 8-CPT-2Me-cAMP sodium8-CPT-2Me-cAMP sodium is a selective activator of exchange proteins activated by cAMP (Epac), the cAMP sensitive guanine nucleotide exchange factors (GEFs) for the small GTPases Rap1 and Rap2. 8-CPT-2Me-cAMP sodium activates Epac1 (EC50 = 2.2 μM), but not PKA (EC50> 10 μM)[1]. 8-CPT-2Me-cAMP sodium stimulates Epac-mediated Ca2+ release in pancreatic β-cells in vitro[2]. |
| Name | sodium,9-[(4aR,6R,7R,7aR)-7-methoxy-2-oxido-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-8-(4-chlorophenyl)sulfanylpurin-6-amine,hydrate |
|---|---|
| Synonym | More Synonyms |
| Description | 8-CPT-2Me-cAMP sodium is a selective activator of exchange proteins activated by cAMP (Epac), the cAMP sensitive guanine nucleotide exchange factors (GEFs) for the small GTPases Rap1 and Rap2. 8-CPT-2Me-cAMP sodium activates Epac1 (EC50 = 2.2 μM), but not PKA (EC50> 10 μM)[1]. 8-CPT-2Me-cAMP sodium stimulates Epac-mediated Ca2+ release in pancreatic β-cells in vitro[2]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 235.5-237.5 ℃(lit.) |
|---|---|
| Molecular Formula | C17H16ClN5NaO6PS |
| Molecular Weight | 525.83600 |
| Exact Mass | 525.02500 |
| PSA | 191.01000 |
| LogP | 3.59640 |
| InChIKey | BCGHHRAUZWOTNH-XNIJJKJLSA-M |
| SMILES | COC1C2OP(=O)([O-])OCC2OC1n1c(Sc2ccc(Cl)cc2)nc2c(N)ncnc21 |
| Safety Phrases | 22-24/25 |
|---|
| 8-pCPT-2gamma-O-Me-cAMP |
| 8-pCPT-2 inverted exclamation marka-O-Me-cAMP |
| 8-pCPT-2'-O-Me-cAMP |