6-Amino-4-hydroxy-2-naphthalenesulfonic acid structure
|
Common Name | 6-Amino-4-hydroxy-2-naphthalenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 90-51-7 | Molecular Weight | 239.248 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 6-Amino-4-hydroxy-2-naphthalenesulfonic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.248 |
| Exact Mass | 239.025223 |
| PSA | 109.00000 |
| LogP | -1.46 |
| Index of Refraction | 1.748 |
| InChIKey | HBZVNWNSRNTWPS-UHFFFAOYSA-N |
| SMILES | Nc1ccc2cc(S(=O)(=O)O)cc(O)c2c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive |
| Risk Phrases | R34 |
| Safety Phrases | S26-S27-S28-S36/37/39-S45 |
| RIDADR | UN 2585 8/PG 3 |
| WGK Germany | 1 |
| RTECS | QK1295250 |
| HS Code | 2922210000 |
|
~%
6-Amino-4-hydro... CAS#:90-51-7 |
|
Literature: Grundlegende Operationen der Farbenchemie, 5. Aufl. |
|
~%
6-Amino-4-hydro... CAS#:90-51-7 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 69, p. 73 Journal fuer Praktische Chemie (Leipzig), , vol. <2> 70, p. 349 |
|
~%
6-Amino-4-hydro... CAS#:90-51-7 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 75, p. 288 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-Amino-4-hydroxy-2-naphthalenesulfonic acid |
| EINECS 202-000-8 |
| 6-amino-4-hydroxynaphthalene-2-sulfonic acid |
| MFCD00003973 |