1,3,7-Naphthalenetrisulfonic acid
Modify Date: 2025-08-27 12:23:34
1,3,7-Naphthalenetrisulfonic acid structure
|
Common Name | 1,3,7-Naphthalenetrisulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 85-49-4 | Molecular Weight | 368.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8O9S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalene-1,3,7-trisulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8O9S3 |
|---|---|
| Molecular Weight | 368.36000 |
| Exact Mass | 367.93300 |
| PSA | 188.25000 |
| LogP | 3.82230 |
| InChIKey | FEWNRIKJXAQRJJ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2cc(S(=O)(=O)O)ccc2c1 |
|
~0%
1,3,7-Naphthale... CAS#:85-49-4 |
| Literature: Wit, Peter De; Cerfontain, Hans Canadian Journal of Chemistry, 1983 , vol. 61, p. 1453 - 1455 |
|
~%
1,3,7-Naphthale... CAS#:85-49-4 |
| Literature: Cassella and Co. Patent: DE75432 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 484 |
|
~%
1,3,7-Naphthale... CAS#:85-49-4 |
| Literature: Bayer and Co. Patent: DE70296 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 420 |
|
~%
1,3,7-Naphthale... CAS#:85-49-4 |
| Literature: Bayer and Co. Patent: DE70296 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 420 |
| Naphthalin-1,3,7-trisulfonsaeure |
| 2,4,6-Naphthalin-trisulfonsaeure |
| 1,3,7-Naphthalenetrisulfonic acid |