3-triethylsilylpropyl 2-methylprop-2-enoate structure
|
Common Name | 3-triethylsilylpropyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 63620-14-4 | Molecular Weight | 242.43000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H26O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-triethylsilylpropyl 2-methylprop-2-enoate |
|---|
| Molecular Formula | C13H26O2Si |
|---|---|
| Molecular Weight | 242.43000 |
| Exact Mass | 242.17000 |
| PSA | 26.30000 |
| LogP | 4.00430 |
| InChIKey | IRMXYFHUDBBVFR-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCC[Si](CC)(CC)CC |
|
~%
3-triethylsilyl... CAS#:63620-14-4 |
| Literature: JOHNSON and JOHNSON VISION CARE, INC.; TORAY INDUSTRIES, INC. Patent: WO2008/42158 A1, 2008 ; Location in patent: Page/Page column 38-39 ; |
|
~%
3-triethylsilyl... CAS#:63620-14-4 |
| Literature: JOHNSON and JOHNSON VISION CARE, INC.; TORAY INDUSTRIES, INC. Patent: WO2008/42158 A1, 2008 ; Location in patent: Page/Page column 39 ; |