N-[(3-(Anilinomethylene)-2-chloro-1-cyclohexen-1-yl)methylene]aniline (hydrochloride) structure
|
Common Name | N-[(3-(Anilinomethylene)-2-chloro-1-cyclohexen-1-yl)methylene]aniline (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 63857-00-1 | Molecular Weight | 359.292 | |
| Density | N/A | Boiling Point | 473.9ºC at 760 mmHg | |
| Molecular Formula | C20H20Cl2N2 | Melting Point | 224ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 240.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-[(3-(Anilinomethylene)-2-chloro-1-cyclohexen-1-yl)methylene]aniline monohydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 473.9ºC at 760 mmHg |
|---|---|
| Melting Point | 224ºC (dec.)(lit.) |
| Molecular Formula | C20H20Cl2N2 |
| Molecular Weight | 359.292 |
| Flash Point | 240.4ºC |
| Exact Mass | 358.100342 |
| PSA | 24.39000 |
| LogP | 6.93670 |
| InChIKey | VFKQWKQWRNVXTA-JLTRPUCESA-N |
| SMILES | Cl.ClC1=C(C=Nc2ccccc2)CCCC1=CNc1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2925290090 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| L6Y BUTJ AU1MR& BG C1UNR &&HCl |
| N,N'-[(2-Chloro-1-cyclohexen-1-yl-3-ylidene)dimethylidyne]bis(benzenamine) hydrochloride |
| MFCD00191759 |
| N-({2-Chloro-3-[(phenylimino)methyl]-2-cyclohexen-1-ylidene}methyl)aniline hydrochloride (1:1) |
| N-({2-Chloro-3-[(phenylimino)methyl]cyclohex-2-en-1-ylidene}methyl)aniline hydrochloride |
| 3-chloro-2,4-trimethylenenglutacondianil hydrochloride |
| Benzenamine, N,N'-[(2-chloro-1-cyclohexen-1-yl-3-ylidene)dimethylidyne]bis-, hydrochloride (1:1) |