N-Boc-L-Norleucine structure
|
Common Name | N-Boc-L-Norleucine | ||
|---|---|---|---|---|
| CAS Number | 6404-28-0 | Molecular Weight | 231.289 | |
| Density | 1.063±0.06 g/cm3 | Boiling Point | 362.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 172.8±23.2 °C | |
Use of N-Boc-L-NorleucineBoc-Nle-OH is a leucine derivative[1]. |
| Name | N-Boc-L-Norleucine |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Nle-OH is a leucine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.063±0.06 g/cm3 |
|---|---|
| Boiling Point | 362.1±25.0 °C at 760 mmHg |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.289 |
| Flash Point | 172.8±23.2 °C |
| Exact Mass | 231.147064 |
| PSA | 75.63000 |
| LogP | 2.69 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | ZIOCIQJXEKFHJO-QMMMGPOBSA-N |
| SMILES | CCCCC(NC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | -15°C |
| Water Solubility | Slightly soluble (1.5 g/L) (25 ºC) |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Inhibition of nitrogen-starved wild type sigma1278b yeast Gap1-mediated amino acid up...
Source: ChEMBL
Target: General amino-acid permease GAP1
External Id: CHEMBL1228071
|
| MFCD00037270 |
| N-(tert-Butoxycarbonyl)-L-norleucine |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-norleucine |
| (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| Boc-Nle-OH |
| N-(tert-Butoxycarbonyl)norleucine |