Pigment Red 12 structure
|
Common Name | Pigment Red 12 | ||
|---|---|---|---|---|
| CAS Number | 6410-32-8 | Molecular Weight | 440.45100 | |
| Density | 1.32 | Boiling Point | 632.7ºC at 760 mmHg | |
| Molecular Formula | C25H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4Z)-4-[(2-methyl-4-nitrophenyl)hydrazinylidene]-N-(2-methylphenyl)-3-oxonaphthalene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 |
|---|---|
| Boiling Point | 632.7ºC at 760 mmHg |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.45100 |
| Exact Mass | 440.14800 |
| PSA | 119.87000 |
| LogP | 7.33430 |
| Index of Refraction | 1.665 |
| InChIKey | KDLDNQQRGJAGIS-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N=Nc1c(O)c(C(=O)Nc2ccccc2C)cc2ccccc12 |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|---|
| Safety Phrases | S24/25 |
| WGK Germany | - |
| RTECS | QH4375000 |
| HS Code | 29159080 |
| HS Code | 29159080 |
|---|
| einecs 229-102-5 |