2,3,4,5-TETRAHYDRO-8-METHYL-1H-PYRIDO[4,3-B]INDOLE structure
|
Common Name | 2,3,4,5-TETRAHYDRO-8-METHYL-1H-PYRIDO[4,3-B]INDOLE | ||
|---|---|---|---|---|
| CAS Number | 64172-41-4 | Molecular Weight | 186.25300 | |
| Density | 1.156g/cm3 | Boiling Point | 364.1ºC at 760 mmHg | |
| Molecular Formula | C12H14N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
| Name | 8-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.156g/cm3 |
|---|---|
| Boiling Point | 364.1ºC at 760 mmHg |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.25300 |
| Flash Point | 174ºC |
| Exact Mass | 186.11600 |
| PSA | 27.82000 |
| LogP | 2.45080 |
| Index of Refraction | 1.652 |
| InChIKey | ZZNXMXVBVZSXEL-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CNCC3 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-methyl-2,3,4,5-tetrahydro-1H-Pyrido<4,3-b>indol |