1,2-Benzenediol,1,2-dimethanesulfonate structure
|
Common Name | 1,2-Benzenediol,1,2-dimethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 64931-04-0 | Molecular Weight | 266.29100 | |
| Density | 1.483g/cm3 | Boiling Point | 451.2ºC at 760mmHg | |
| Molecular Formula | C8H10O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7ºC | |
| Name | (2-methylsulfonyloxyphenyl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.483g/cm3 |
|---|---|
| Boiling Point | 451.2ºC at 760mmHg |
| Molecular Formula | C8H10O6S2 |
| Molecular Weight | 266.29100 |
| Flash Point | 226.7ºC |
| Exact Mass | 265.99200 |
| PSA | 103.50000 |
| LogP | 2.52500 |
| Index of Refraction | 1.549 |
| InChIKey | DUTKQZIXCWCJHV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)Oc1ccccc1OS(C)(=O)=O |
|
~98%
1,2-Benzenediol... CAS#:64931-04-0 |
| Literature: Castellino, Angelo J.; Rapoport, Henry Journal of Organic Chemistry, 1984 , vol. 49, p. 1348 - 1352 |
|
~%
1,2-Benzenediol... CAS#:64931-04-0 |
| Literature: Helferich; Papalambrou Justus Liebigs Annalen der Chemie, 1942 , vol. 551, p. 235,241 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Di-O-methansulfonyl-brenzcatechin |
| 1,2-bis-methanesulfonyloxy-benzene |
| 1,2-Bis-methansulfonyloxy-benzol |
| 1,2-Dimethylsulfonyloxybenzol |
| 1,2-bis<(methylsulfonyl)oxy>benzene |
| catechol dimethanesulfonate |