Z-Gly-Pro-pNA structure
|
Common Name | Z-Gly-Pro-pNA | ||
|---|---|---|---|---|
| CAS Number | 65022-15-3 | Molecular Weight | 426.423 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 738.7±60.0 °C at 760 mmHg | |
| Molecular Formula | C21H22N4O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 400.5±32.9 °C | |
Use of Z-Gly-Pro-pNAZ-Gly-Pro-pNA is a substrate for measuring prolyl endopeptidase (PEP) inhibitory activity[1]. |
| Name | benzyl N-[2-[(2S)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Gly-Pro-pNA is a substrate for measuring prolyl endopeptidase (PEP) inhibitory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 738.7±60.0 °C at 760 mmHg |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.423 |
| Flash Point | 400.5±32.9 °C |
| Exact Mass | 426.153931 |
| PSA | 133.56000 |
| LogP | 3.00 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | UTXSFKPOIVELPQ-SFHVURJKSA-N |
| SMILES | O=C(NCC(=O)N1CCCC1C(=O)Nc1ccc([N+](=O)[O-])cc1)OCc1ccccc1 |
| Storage condition | -20 °C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
K. Hauzer et al.
Collect. Czech. Chem. Commun. 47 , 1139, (1982)
|
| Z-Gly-L-Pro-4-nitroanilide |
| L-Prolinamide, N-[(phenylmethoxy)carbonyl]glycyl-N-(4-nitrophenyl)- |
| N-Benzyloxycarbonyl-glycyl-L-proline p-nitroanilide |
| MFCD00038815 |
| N-[(Benzyloxy)carbonyl]glycyl-N-(4-nitrophenyl)-L-prolinamide |
| Z-Gly-Pro-pNA |
| N-CBZ-Glycyl-L-proline 4-nitroanilide |
| benzyloxycarbonylglycyl-proline 4-nitranilide |
| Z-glycyl-L-proline-4-nitroanilide |
| Z-Gly-Pro-4-nitroanilide |