[4-(Benzyloxy)phenyl]acetic acid structure
|
Common Name | [4-(Benzyloxy)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 6547-53-1 | Molecular Weight | 242.270 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 418.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | 119-123 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 158.5±16.7 °C | |
| Name | 4-Benzyloxyphenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 418.8±25.0 °C at 760 mmHg |
| Melting Point | 119-123 °C(lit.) |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.270 |
| Flash Point | 158.5±16.7 °C |
| Exact Mass | 242.094299 |
| PSA | 46.53000 |
| LogP | 3.08 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | XJHGAJLIKDAOPE-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccc(OCc2ccccc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
A novel derivative of betulinic acid, SYK023, suppresses lung cancer growth and malignancy.
Oncotarget 6 , 13671-87, (2015) Herein, we evaluated the anti-cancer effect and molecular mechanisms of a novel betulinic acid (BA) derivative, SYK023, by using two mouse models of lung cancer driven by KrasG12D or EGFRL858R. We fou... |
|
|
[4-(Benzyloxy) phenyl] acetic acid, C15H14O3. Bats JW and Canenbley R.
Acta Crystallogr. C 40(6) , 993-995, (1984)
|
|
|
Crystallographic studies and physicochemical properties of Π-electron compounds. XVII. The structure of p-nitrophenylacetic acid. Grabowski SJ, et al.
Acta Crystallogr. C 46(3) , 428-430, (1990)
|
| EINECS 229-463-9 |
| MFCD00017540 |
| [4-(Benzyloxy)phenyl]acetic acid |
| Benzeneacetic acid, 4-(phenylmethoxy)- |
| 2-[4-(benzyloxy)phenyl]acetic acid |
| 2-(4-phenylmethoxyphenyl)acetic acid |