Bis-PEG1-NHS ester structure
|
Common Name | Bis-PEG1-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 65869-64-9 | Molecular Weight | 356.285 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 511.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C14H16N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.1±32.9 °C | |
Use of Bis-PEG1-NHS esterBis-PEG1-NHS ester is a nonclaevable 1-unit PEG linker for antibody-drug-conjugation (ADC). |
| Name | 1,1'-{Oxybis[(1-oxo-3,1-propanediyl)oxy]}di(2,5-pyrrolidinedione) |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-PEG1-NHS ester is a nonclaevable 1-unit PEG linker for antibody-drug-conjugation (ADC). |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 511.4±60.0 °C at 760 mmHg |
| Molecular Formula | C14H16N2O9 |
| Molecular Weight | 356.285 |
| Flash Point | 263.1±32.9 °C |
| Exact Mass | 356.085571 |
| LogP | -3.51 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | OWCYSDGIJAVHFQ-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| Storage condition | -20°C |
| 1,1'-{Oxybis[(1-oxo-3,1-propanediyl)oxy]}di(2,5-pyrrolidinedione) |
| MFCD20226397 |
| 2,5-Pyrrolidinedione, 1,1'-[oxybis[(1-oxo-3,1-propanediyl)oxy]]bis- |