Succinimid cyl-2,2,2-trichloroethyl carbonate structure
|
Common Name | Succinimid cyl-2,2,2-trichloroethyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 66065-85-8 | Molecular Weight | 290.485 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 327.5±52.0 °C at 760 mmHg | |
| Molecular Formula | C7H6Cl3NO5 | Melting Point | 111-113ºC | |
| MSDS | Chinese USA | Flash Point | 151.9±30.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Succinimidyl 2,2,2-trichloroethyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 327.5±52.0 °C at 760 mmHg |
| Melting Point | 111-113ºC |
| Molecular Formula | C7H6Cl3NO5 |
| Molecular Weight | 290.485 |
| Flash Point | 151.9±30.7 °C |
| Exact Mass | 288.931152 |
| PSA | 72.91000 |
| LogP | 0.62 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | WBZXNGAFYBGQFE-UHFFFAOYSA-N |
| SMILES | O=C(OCC(Cl)(Cl)Cl)ON1C(=O)CCC1=O |
| Storage condition | 2-8°C |
| Water Solubility | Soluble in dioxane, THF, DMF, CH2Cl2, alcohols, and most common organic solvents. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22;R36/37 |
| Safety Phrases | S26-S27-S28-S36/37/39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HS Code | 2925190090 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis of a sialic acid dimer derivative, 2'alpha-O-benzyl Neu5Ac-alph-(2-->5)Neu5Gc.
J. Org. Chem. 67(4) , 1376-79, (2002) The preparation of a disaccharide 2, Neu5Ac-alpha-(2-->5)Neu5Gc having a alpha-benzyl protecting group at the reducing end, by the coupling of the easily accessible building units 4 and 5 is described... |
|
|
Synthesis of a tetrasaccharide glycosyl glycerol. Precursor to glycolipids of Meiothermus taiwanensis ATCC BAA-400.
J. Org. Chem. 72(14) , 5427-30, (2007) Synthesis of a tetrasaccharide glycosyl glycerol, the core structure of glycoglycerolipid from Meiothermus taiwanensis ATCC BAA-400, was described. A one-pot glycosylation with three components was em... |
| 2,5-Pyrrolidinedione, 1-[[(2,2,2-trichloroethoxy)carbonyl]oxy]- |
| 1-{[(2,2,2-Trichloroethoxy)carbonyl]oxy}pyrrolidine-2,5-dione |
| MFCD00075216 |
| 1-{[(2,2,2-Trichloroethoxy)carbonyl]oxy}-2,5-pyrrolidinedione |
| (2,5-dioxopyrrolidin-1-yl) 2,2,2-trichloroethyl carbonate |